About 2-chloro-N,N-bis(2-chloropropyl)propan-1-amine;hydrochloride
2-chloro-N,N-bis(2-chloropropyl)propan-1-amine;hydrochloride (PubChem CID 3025277) has the molecular formula C9H19Cl4N
and a molecular weight of 283.07 g/mol. Its IUPAC name is 2-chloro-N,N-bis(2-chloropropyl)propan-1-amine;hydrochloride.
Molecular Properties
| Compound Name | 2-chloro-N,N-bis(2-chloropropyl)propan-1-amine;hydrochloride |
| PubChem CID | 3025277 |
| Molecular Formula | C9H19Cl4N |
| Molecular Weight | 283.07 g/mol |
| Exact Mass | 281.03 |
| IUPAC Name | 2-chloro-N,N-bis(2-chloropropyl)propan-1-amine;hydrochloride |
| SMILES | CC(Cl)CN(CC(C)Cl)CC(C)Cl.Cl |
| InChI | InChI=1S/C9H18Cl3N.ClH/c1-7(10)4-13(5-8(2)11)6-9(3)12;/h7-9H,4-6H2,1-3H3;1H |
| InChIKey | ZWSYMPJBDBFEJI-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.07 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-N,N-bis(2-chloropropyl)propan-1-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-N,N-bis(2-chloropropyl)propan-1-amine;hydrochloride?
The IUPAC name of 2-chloro-N,N-bis(2-chloropropyl)propan-1-amine;hydrochloride (CID 3025277) is 2-chloro-N,N-bis(2-chloropropyl)propan-1-amine;hydrochloride.
What is the SMILES notation for 2-chloro-N,N-bis(2-chloropropyl)propan-1-amine;hydrochloride?
The canonical SMILES for 2-chloro-N,N-bis(2-chloropropyl)propan-1-amine;hydrochloride is CC(Cl)CN(CC(C)Cl)CC(C)Cl.Cl.
What is the InChIKey of 2-chloro-N,N-bis(2-chloropropyl)propan-1-amine;hydrochloride?
The InChIKey is ZWSYMPJBDBFEJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18Cl3N.ClH/c1-7(10)4-13(5-8(2)11)6-9(3)12;/h7-9H,4-6H2,1-3H3;1H.
What are the key properties of 2-chloro-N,N-bis(2-chloropropyl)propan-1-amine;hydrochloride?
2-chloro-N,N-bis(2-chloropropyl)propan-1-amine;hydrochloride has a molecular weight of 283.07 g/mol, XLogP of 3.59, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-N,N-bis(2-chloropropyl)propan-1-amine;hydrochloride is sourced from PubChem (CID 3025277), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).