About N,N'-bis(2-chloroethyl)-N,N'-dimethylpropane-1,3-diamine
N,N'-bis(2-chloroethyl)-N,N'-dimethylpropane-1,3-diamine (PubChem CID 3025321) has the molecular formula C9H20Cl2N2
and a molecular weight of 227.18 g/mol. Its IUPAC name is N,N'-bis(2-chloroethyl)-N,N'-dimethylpropane-1,3-diamine.
Molecular Properties
| Compound Name | N,N'-bis(2-chloroethyl)-N,N'-dimethylpropane-1,3-diamine |
| PubChem CID | 3025321 |
| Molecular Formula | C9H20Cl2N2 |
| Molecular Weight | 227.18 g/mol |
| Exact Mass | 226.10 |
| IUPAC Name | N,N'-bis(2-chloroethyl)-N,N'-dimethylpropane-1,3-diamine |
| SMILES | CN(CCCl)CCCN(C)CCCl |
| InChI | InChI=1S/C9H20Cl2N2/c1-12(8-4-10)6-3-7-13(2)9-5-11/h3-9H2,1-2H3 |
| InChIKey | DGZBGPQUUHWNRR-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.18 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze N,N'-bis(2-chloroethyl)-N,N'-dimethylpropane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N'-bis(2-chloroethyl)-N,N'-dimethylpropane-1,3-diamine?
The IUPAC name of N,N'-bis(2-chloroethyl)-N,N'-dimethylpropane-1,3-diamine (CID 3025321) is N,N'-bis(2-chloroethyl)-N,N'-dimethylpropane-1,3-diamine.
What is the SMILES notation for N,N'-bis(2-chloroethyl)-N,N'-dimethylpropane-1,3-diamine?
The canonical SMILES for N,N'-bis(2-chloroethyl)-N,N'-dimethylpropane-1,3-diamine is CN(CCCl)CCCN(C)CCCl.
What is the InChIKey of N,N'-bis(2-chloroethyl)-N,N'-dimethylpropane-1,3-diamine?
The InChIKey is DGZBGPQUUHWNRR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H20Cl2N2/c1-12(8-4-10)6-3-7-13(2)9-5-11/h3-9H2,1-2H3.
What are the key properties of N,N'-bis(2-chloroethyl)-N,N'-dimethylpropane-1,3-diamine?
N,N'-bis(2-chloroethyl)-N,N'-dimethylpropane-1,3-diamine has a molecular weight of 227.18 g/mol, XLogP of 1.72, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,N'-bis(2-chloroethyl)-N,N'-dimethylpropane-1,3-diamine is sourced from PubChem (CID 3025321), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).