About 2,3-dibromo-N,N-diethylpropan-1-amine
2,3-dibromo-N,N-diethylpropan-1-amine (PubChem CID 3025403) has the molecular formula C7H15Br2N
and a molecular weight of 273.01 g/mol. Its IUPAC name is 2,3-dibromo-N,N-diethylpropan-1-amine.
Molecular Properties
| Compound Name | 2,3-dibromo-N,N-diethylpropan-1-amine |
| PubChem CID | 3025403 |
| Molecular Formula | C7H15Br2N |
| Molecular Weight | 273.01 g/mol |
| Exact Mass | 270.96 |
| IUPAC Name | 2,3-dibromo-N,N-diethylpropan-1-amine |
| SMILES | CCN(CC)CC(Br)CBr |
| InChI | InChI=1S/C7H15Br2N/c1-3-10(4-2)6-7(9)5-8/h7H,3-6H2,1-2H3 |
| InChIKey | QVPBZFNOUMSOCN-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.01 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2,3-dibromo-N,N-diethylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dibromo-N,N-diethylpropan-1-amine?
The IUPAC name of 2,3-dibromo-N,N-diethylpropan-1-amine (CID 3025403) is 2,3-dibromo-N,N-diethylpropan-1-amine.
What is the SMILES notation for 2,3-dibromo-N,N-diethylpropan-1-amine?
The canonical SMILES for 2,3-dibromo-N,N-diethylpropan-1-amine is CCN(CC)CC(Br)CBr.
What is the InChIKey of 2,3-dibromo-N,N-diethylpropan-1-amine?
The InChIKey is QVPBZFNOUMSOCN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15Br2N/c1-3-10(4-2)6-7(9)5-8/h7H,3-6H2,1-2H3.
What are the key properties of 2,3-dibromo-N,N-diethylpropan-1-amine?
2,3-dibromo-N,N-diethylpropan-1-amine has a molecular weight of 273.01 g/mol, XLogP of 2.49, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dibromo-N,N-diethylpropan-1-amine is sourced from PubChem (CID 3025403), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).