About N'-(6-bromo-1,3-benzothiazol-2-yl)-N-methyloxamide
N'-(6-bromo-1,3-benzothiazol-2-yl)-N-methyloxamide (PubChem CID 3025599) has the molecular formula C10H8BrN3O2S
and a molecular weight of 314.16 g/mol. Its IUPAC name is N'-(6-bromo-1,3-benzothiazol-2-yl)-N-methyloxamide.
Molecular Properties
| Compound Name | N'-(6-bromo-1,3-benzothiazol-2-yl)-N-methyloxamide |
| PubChem CID | 3025599 |
| Molecular Formula | C10H8BrN3O2S |
| Molecular Weight | 314.16 g/mol |
| Exact Mass | 312.95 |
| IUPAC Name | N'-(6-bromo-1,3-benzothiazol-2-yl)-N-methyloxamide |
| SMILES | CNC(=O)C(=O)Nc1nc2ccc(Br)cc2s1 |
| InChI | InChI=1S/C10H8BrN3O2S/c1-12-8(15)9(16)14-10-13-6-3-2-5(11)4-7(6)17-10/h2-4H,1H3,(H,12,15)(H,13,14,16) |
| InChIKey | CAHHZWIMGMIKJV-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.16 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze N'-(6-bromo-1,3-benzothiazol-2-yl)-N-methyloxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(6-bromo-1,3-benzothiazol-2-yl)-N-methyloxamide?
The IUPAC name of N'-(6-bromo-1,3-benzothiazol-2-yl)-N-methyloxamide (CID 3025599) is N'-(6-bromo-1,3-benzothiazol-2-yl)-N-methyloxamide.
What is the SMILES notation for N'-(6-bromo-1,3-benzothiazol-2-yl)-N-methyloxamide?
The canonical SMILES for N'-(6-bromo-1,3-benzothiazol-2-yl)-N-methyloxamide is CNC(=O)C(=O)Nc1nc2ccc(Br)cc2s1.
What is the InChIKey of N'-(6-bromo-1,3-benzothiazol-2-yl)-N-methyloxamide?
The InChIKey is CAHHZWIMGMIKJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8BrN3O2S/c1-12-8(15)9(16)14-10-13-6-3-2-5(11)4-7(6)17-10/h2-4H,1H3,(H,12,15)(H,13,14,16).
What are the key properties of N'-(6-bromo-1,3-benzothiazol-2-yl)-N-methyloxamide?
N'-(6-bromo-1,3-benzothiazol-2-yl)-N-methyloxamide has a molecular weight of 314.16 g/mol, XLogP of 1.74, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(6-bromo-1,3-benzothiazol-2-yl)-N-methyloxamide is sourced from PubChem (CID 3025599), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).