C13H13FN2O — CID 3025607
9-amino-6-fluoro-1,2,3,4-tetrahydroacridin-1-ol (PubChem CID 3025607) has the molecular formula C13H13FN2O and a molecular weight of 232.26 g/mol. Its IUPAC name is 9-amino-6-fluoro-1,2,3,4-tetrahydroacridin-1-ol.
| Compound Name | 9-amino-6-fluoro-1,2,3,4-tetrahydroacridin-1-ol |
|---|---|
| PubChem CID | 3025607 |
| Molecular Formula | C13H13FN2O |
| Molecular Weight | 232.26 g/mol |
| Exact Mass | 232.10 |
| IUPAC Name | 9-amino-6-fluoro-1,2,3,4-tetrahydroacridin-1-ol |
| SMILES | Nc1c2c(nc3cc(F)ccc13)CCCC2O |
| InChI | InChI=1S/C13H13FN2O/c14-7-4-5-8-10(6-7)16-9-2-1-3-11(17)12(9)13(8)15/h4-6,11,17H,1-3H2,(H2,15,16) |
| InChIKey | GHPCZOLZFWUXCH-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 59.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.26 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |