C14H13F3N2O — CID 3025608
9-amino-6-(trifluoromethyl)-1,2,3,4-tetrahydroacridin-1-ol (PubChem CID 3025608) has the molecular formula C14H13F3N2O and a molecular weight of 282.26 g/mol. Its IUPAC name is 9-amino-6-(trifluoromethyl)-1,2,3,4-tetrahydroacridin-1-ol.
| Compound Name | 9-amino-6-(trifluoromethyl)-1,2,3,4-tetrahydroacridin-1-ol |
|---|---|
| PubChem CID | 3025608 |
| Molecular Formula | C14H13F3N2O |
| Molecular Weight | 282.26 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | 9-amino-6-(trifluoromethyl)-1,2,3,4-tetrahydroacridin-1-ol |
| SMILES | Nc1c2c(nc3cc(C(F)(F)F)ccc13)CCCC2O |
| InChI | InChI=1S/C14H13F3N2O/c15-14(16,17)7-4-5-8-10(6-7)19-9-2-1-3-11(20)12(9)13(8)18/h4-6,11,20H,1-3H2,(H2,18,19) |
| InChIKey | ZHFXMERFRYSFFB-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 59.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.26 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |