C17H23N3O — CID 3025609
9-[2-(dimethylamino)ethylamino]-1,2,3,4-tetrahydroacridin-1-ol (PubChem CID 3025609) has the molecular formula C17H23N3O and a molecular weight of 285.39 g/mol. Its IUPAC name is 9-[2-(dimethylamino)ethylamino]-1,2,3,4-tetrahydroacridin-1-ol.
| Compound Name | 9-[2-(dimethylamino)ethylamino]-1,2,3,4-tetrahydroacridin-1-ol |
|---|---|
| PubChem CID | 3025609 |
| Molecular Formula | C17H23N3O |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.18 |
| IUPAC Name | 9-[2-(dimethylamino)ethylamino]-1,2,3,4-tetrahydroacridin-1-ol |
| SMILES | CN(C)CCNc1c2c(nc3ccccc13)CCCC2O |
| InChI | InChI=1S/C17H23N3O/c1-20(2)11-10-18-17-12-6-3-4-7-13(12)19-14-8-5-9-15(21)16(14)17/h3-4,6-7,15,21H,5,8-11H2,1-2H3,(H,18,19) |
| InChIKey | XMAVZCCINJYMNG-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 48.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |