C15H24N2O4S — CID 30256331
2-(3-ethoxy-N-methylsulfonylanilino)-N,N-diethylacetamide (PubChem CID 30256331) has the molecular formula C15H24N2O4S and a molecular weight of 328.43 g/mol. Its IUPAC name is 2-(3-ethoxy-N-methylsulfonylanilino)-N,N-diethylacetamide.
| Compound Name | 2-(3-ethoxy-N-methylsulfonylanilino)-N,N-diethylacetamide |
|---|---|
| PubChem CID | 30256331 |
| Molecular Formula | C15H24N2O4S |
| Molecular Weight | 328.43 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | 2-(3-ethoxy-N-methylsulfonylanilino)-N,N-diethylacetamide |
| SMILES | CCOc1cccc(N(CC(=O)N(CC)CC)S(C)(=O)=O)c1 |
| InChI | InChI=1S/C15H24N2O4S/c1-5-16(6-2)15(18)12-17(22(4,19)20)13-9-8-10-14(11-13)21-7-3/h8-11H,5-7,12H2,1-4H3 |
| InChIKey | QWCVUTNQGLGQSF-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.43 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |