About 10-[2-(dimethylamino)ethyl]-1,4-dimethoxyacridin-9-one
10-[2-(dimethylamino)ethyl]-1,4-dimethoxyacridin-9-one (PubChem CID 3025757) has the molecular formula C19H22N2O3
and a molecular weight of 326.40 g/mol. Its IUPAC name is 10-[2-(dimethylamino)ethyl]-1,4-dimethoxyacridin-9-one.
Molecular Properties
| Compound Name | 10-[2-(dimethylamino)ethyl]-1,4-dimethoxyacridin-9-one |
| PubChem CID | 3025757 |
| Molecular Formula | C19H22N2O3 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.16 |
| IUPAC Name | 10-[2-(dimethylamino)ethyl]-1,4-dimethoxyacridin-9-one |
| SMILES | COc1ccc(OC)c2c1c(=O)c1ccccc1n2CCN(C)C |
| InChI | InChI=1S/C19H22N2O3/c1-20(2)11-12-21-14-8-6-5-7-13(14)19(22)17-15(23-3)9-10-16(24-4)18(17)21/h5-10H,11-12H2,1-4H3 |
| InChIKey | CERRTOVBHOLSLM-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 43.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 10-[2-(dimethylamino)ethyl]-1,4-dimethoxyacridin-9-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-[2-(dimethylamino)ethyl]-1,4-dimethoxyacridin-9-one?
The IUPAC name of 10-[2-(dimethylamino)ethyl]-1,4-dimethoxyacridin-9-one (CID 3025757) is 10-[2-(dimethylamino)ethyl]-1,4-dimethoxyacridin-9-one.
What is the SMILES notation for 10-[2-(dimethylamino)ethyl]-1,4-dimethoxyacridin-9-one?
The canonical SMILES for 10-[2-(dimethylamino)ethyl]-1,4-dimethoxyacridin-9-one is COc1ccc(OC)c2c1c(=O)c1ccccc1n2CCN(C)C.
What is the InChIKey of 10-[2-(dimethylamino)ethyl]-1,4-dimethoxyacridin-9-one?
The InChIKey is CERRTOVBHOLSLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22N2O3/c1-20(2)11-12-21-14-8-6-5-7-13(14)19(22)17-15(23-3)9-10-16(24-4)18(17)21/h5-10H,11-12H2,1-4H3.
What are the key properties of 10-[2-(dimethylamino)ethyl]-1,4-dimethoxyacridin-9-one?
10-[2-(dimethylamino)ethyl]-1,4-dimethoxyacridin-9-one has a molecular weight of 326.40 g/mol, XLogP of 2.73, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 10-[2-(dimethylamino)ethyl]-1,4-dimethoxyacridin-9-one is sourced from PubChem (CID 3025757), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).