About 6-amino-1,2-dihydrochrysene-1,2-diol
6-amino-1,2-dihydrochrysene-1,2-diol (PubChem CID 3025891) has the molecular formula C18H15NO2
and a molecular weight of 277.32 g/mol. Its IUPAC name is 6-amino-1,2-dihydrochrysene-1,2-diol.
Molecular Properties
| Compound Name | 6-amino-1,2-dihydrochrysene-1,2-diol |
| PubChem CID | 3025891 |
| Molecular Formula | C18H15NO2 |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | 6-amino-1,2-dihydrochrysene-1,2-diol |
| SMILES | Nc1cc2c3c(ccc2c2ccccc12)C(O)C(O)C=C3 |
| InChI | InChI=1S/C18H15NO2/c19-16-9-15-11(10-3-1-2-4-13(10)16)5-6-14-12(15)7-8-17(20)18(14)21/h1-9,17-18,20-21H,19H2 |
| InChIKey | BDQUGJCOXDENQA-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 6-amino-1,2-dihydrochrysene-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-amino-1,2-dihydrochrysene-1,2-diol?
The IUPAC name of 6-amino-1,2-dihydrochrysene-1,2-diol (CID 3025891) is 6-amino-1,2-dihydrochrysene-1,2-diol.
What is the SMILES notation for 6-amino-1,2-dihydrochrysene-1,2-diol?
The canonical SMILES for 6-amino-1,2-dihydrochrysene-1,2-diol is Nc1cc2c3c(ccc2c2ccccc12)C(O)C(O)C=C3.
What is the InChIKey of 6-amino-1,2-dihydrochrysene-1,2-diol?
The InChIKey is BDQUGJCOXDENQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15NO2/c19-16-9-15-11(10-3-1-2-4-13(10)16)5-6-14-12(15)7-8-17(20)18(14)21/h1-9,17-18,20-21H,19H2.
What are the key properties of 6-amino-1,2-dihydrochrysene-1,2-diol?
6-amino-1,2-dihydrochrysene-1,2-diol has a molecular weight of 277.32 g/mol, XLogP of 3.00, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-1,2-dihydrochrysene-1,2-diol is sourced from PubChem (CID 3025891), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).