C9H13N5O2 — CID 3025970
2-[(2-aminopurin-9-yl)methyl]propane-1,3-diol (PubChem CID 3025970) has the molecular formula C9H13N5O2 and a molecular weight of 223.24 g/mol. Its IUPAC name is 2-[(2-aminopurin-9-yl)methyl]propane-1,3-diol.
| Compound Name | 2-[(2-aminopurin-9-yl)methyl]propane-1,3-diol |
|---|---|
| PubChem CID | 3025970 |
| Molecular Formula | C9H13N5O2 |
| Molecular Weight | 223.24 g/mol |
| Exact Mass | 223.11 |
| IUPAC Name | 2-[(2-aminopurin-9-yl)methyl]propane-1,3-diol |
| SMILES | Nc1ncc2ncn(CC(CO)CO)c2n1 |
| InChI | InChI=1S/C9H13N5O2/c10-9-11-1-7-8(13-9)14(5-12-7)2-6(3-15)4-16/h1,5-6,15-16H,2-4H2,(H2,10,11,13) |
| InChIKey | PIWJGZWZNOWIGH-UHFFFAOYSA-N |
| XLogP | -0.99 |
| TPSA | 110.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.24 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |