C15H22N2O3 — CID 3026215
2-(N-acetyl-2-propan-2-yloxyanilino)-N,N-dimethylacetamide (PubChem CID 3026215) has the molecular formula C15H22N2O3 and a molecular weight of 278.35 g/mol. Its IUPAC name is 2-(N-acetyl-2-propan-2-yloxyanilino)-N,N-dimethylacetamide.
| Compound Name | 2-(N-acetyl-2-propan-2-yloxyanilino)-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 3026215 |
| Molecular Formula | C15H22N2O3 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.16 |
| IUPAC Name | 2-(N-acetyl-2-propan-2-yloxyanilino)-N,N-dimethylacetamide |
| SMILES | CC(=O)N(CC(=O)N(C)C)c1ccccc1OC(C)C |
| InChI | InChI=1S/C15H22N2O3/c1-11(2)20-14-9-7-6-8-13(14)17(12(3)18)10-15(19)16(4)5/h6-9,11H,10H2,1-5H3 |
| InChIKey | NNVQCFZGTJJGLZ-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |