About bromomethane;ethyl 4-[2-(diethylamino)propanoylamino]benzoate
bromomethane;ethyl 4-[2-(diethylamino)propanoylamino]benzoate (PubChem CID 3026437) has the molecular formula C17H27BrN2O3
and a molecular weight of 387.32 g/mol. Its IUPAC name is bromomethane;ethyl 4-[2-(diethylamino)propanoylamino]benzoate.
Molecular Properties
| Compound Name | bromomethane;ethyl 4-[2-(diethylamino)propanoylamino]benzoate |
| PubChem CID | 3026437 |
| Molecular Formula | C17H27BrN2O3 |
| Molecular Weight | 387.32 g/mol |
| Exact Mass | 386.12 |
| IUPAC Name | bromomethane;ethyl 4-[2-(diethylamino)propanoylamino]benzoate |
| SMILES | CBr.CCOC(=O)c1ccc(NC(=O)C(C)N(CC)CC)cc1 |
| InChI | InChI=1S/C16H24N2O3.CH3Br/c1-5-18(6-2)12(4)15(19)17-14-10-8-13(9-11-14)16(20)21-7-3;1-2/h8-12H,5-7H2,1-4H3,(H,17,19);1H3 |
| InChIKey | MALRBXRXEDSUHQ-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 387.32 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze bromomethane;ethyl 4-[2-(diethylamino)propanoylamino]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bromomethane;ethyl 4-[2-(diethylamino)propanoylamino]benzoate?
The IUPAC name of bromomethane;ethyl 4-[2-(diethylamino)propanoylamino]benzoate (CID 3026437) is bromomethane;ethyl 4-[2-(diethylamino)propanoylamino]benzoate.
What is the SMILES notation for bromomethane;ethyl 4-[2-(diethylamino)propanoylamino]benzoate?
The canonical SMILES for bromomethane;ethyl 4-[2-(diethylamino)propanoylamino]benzoate is CBr.CCOC(=O)c1ccc(NC(=O)C(C)N(CC)CC)cc1.
What is the InChIKey of bromomethane;ethyl 4-[2-(diethylamino)propanoylamino]benzoate?
The InChIKey is MALRBXRXEDSUHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24N2O3.CH3Br/c1-5-18(6-2)12(4)15(19)17-14-10-8-13(9-11-14)16(20)21-7-3;1-2/h8-12H,5-7H2,1-4H3,(H,17,19);1H3.
What are the key properties of bromomethane;ethyl 4-[2-(diethylamino)propanoylamino]benzoate?
bromomethane;ethyl 4-[2-(diethylamino)propanoylamino]benzoate has a molecular weight of 387.32 g/mol, XLogP of 3.54, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bromomethane;ethyl 4-[2-(diethylamino)propanoylamino]benzoate is sourced from PubChem (CID 3026437), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).