C22H25N — CID 3026468
4,4-diphenyl-N,N-bis(prop-2-enyl)but-3-en-1-amine (PubChem CID 3026468) has the molecular formula C22H25N and a molecular weight of 303.45 g/mol. Its IUPAC name is 4,4-diphenyl-N,N-bis(prop-2-enyl)but-3-en-1-amine.
| Compound Name | 4,4-diphenyl-N,N-bis(prop-2-enyl)but-3-en-1-amine |
|---|---|
| PubChem CID | 3026468 |
| Molecular Formula | C22H25N |
| Molecular Weight | 303.45 g/mol |
| Exact Mass | 303.20 |
| IUPAC Name | 4,4-diphenyl-N,N-bis(prop-2-enyl)but-3-en-1-amine |
| SMILES | C=CCN(CC=C)CCC=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H25N/c1-3-17-23(18-4-2)19-11-16-22(20-12-7-5-8-13-20)21-14-9-6-10-15-21/h3-10,12-16H,1-2,11,17-19H2 |
| InChIKey | KJFSZVKLTYUXOP-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.45 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|