C19H16N2O3 — CID 3026925
5-(4-phenylphenyl)-5-prop-2-enyl-1,3-diazinane-2,4,6-trione (PubChem CID 3026925) has the molecular formula C19H16N2O3 and a molecular weight of 320.35 g/mol. Its IUPAC name is 5-(4-phenylphenyl)-5-prop-2-enyl-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-(4-phenylphenyl)-5-prop-2-enyl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 3026925 |
| Molecular Formula | C19H16N2O3 |
| Molecular Weight | 320.35 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | 5-(4-phenylphenyl)-5-prop-2-enyl-1,3-diazinane-2,4,6-trione |
| SMILES | C=CCC1(c2ccc(-c3ccccc3)cc2)C(=O)NC(=O)NC1=O |
| InChI | InChI=1S/C19H16N2O3/c1-2-12-19(16(22)20-18(24)21-17(19)23)15-10-8-14(9-11-15)13-6-4-3-5-7-13/h2-11H,1,12H2,(H2,20,21,22,23,24) |
| InChIKey | KDBHSHLPVVXOAN-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.35 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|