C11H12N2O3S — CID 3026971
5-ethyl-5-(thiophen-2-ylmethyl)-1,3-diazinane-2,4,6-trione (PubChem CID 3026971) has the molecular formula C11H12N2O3S and a molecular weight of 252.29 g/mol. Its IUPAC name is 5-ethyl-5-(thiophen-2-ylmethyl)-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-ethyl-5-(thiophen-2-ylmethyl)-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 3026971 |
| Molecular Formula | C11H12N2O3S |
| Molecular Weight | 252.29 g/mol |
| Exact Mass | 252.06 |
| IUPAC Name | 5-ethyl-5-(thiophen-2-ylmethyl)-1,3-diazinane-2,4,6-trione |
| SMILES | CCC1(Cc2cccs2)C(=O)NC(=O)NC1=O |
| InChI | InChI=1S/C11H12N2O3S/c1-2-11(6-7-4-3-5-17-7)8(14)12-10(16)13-9(11)15/h3-5H,2,6H2,1H3,(H2,12,13,14,15,16) |
| InChIKey | KEQFKSBXRZEAIF-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.29 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|