About N-[5-[4-[bis(2,3-dihydroxypropyl)amino]phenoxy]pentyl]benzamide
N-[5-[4-[bis(2,3-dihydroxypropyl)amino]phenoxy]pentyl]benzamide (PubChem CID 3027024) has the molecular formula C24H34N2O6
and a molecular weight of 446.54 g/mol. Its IUPAC name is N-[5-[4-[bis(2,3-dihydroxypropyl)amino]phenoxy]pentyl]benzamide.
Molecular Properties
| Compound Name | N-[5-[4-[bis(2,3-dihydroxypropyl)amino]phenoxy]pentyl]benzamide |
| PubChem CID | 3027024 |
| Molecular Formula | C24H34N2O6 |
| Molecular Weight | 446.54 g/mol |
| Exact Mass | 446.24 |
| IUPAC Name | N-[5-[4-[bis(2,3-dihydroxypropyl)amino]phenoxy]pentyl]benzamide |
| SMILES | O=C(NCCCCCOc1ccc(N(CC(O)CO)CC(O)CO)cc1)c1ccccc1 |
| InChI | InChI=1S/C24H34N2O6/c27-17-21(29)15-26(16-22(30)18-28)20-9-11-23(12-10-20)32-14-6-2-5-13-25-24(31)19-7-3-1-4-8-19/h1,3-4,7-12,21-22,27-30H,2,5-6,13-18H2,(H,25,31) |
| InChIKey | RMHRLHWWWNUBLZ-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 122.49 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 446.54 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[5-[4-[bis(2,3-dihydroxypropyl)amino]phenoxy]pentyl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[5-[4-[bis(2,3-dihydroxypropyl)amino]phenoxy]pentyl]benzamide?
The IUPAC name of N-[5-[4-[bis(2,3-dihydroxypropyl)amino]phenoxy]pentyl]benzamide (CID 3027024) is N-[5-[4-[bis(2,3-dihydroxypropyl)amino]phenoxy]pentyl]benzamide.
What is the SMILES notation for N-[5-[4-[bis(2,3-dihydroxypropyl)amino]phenoxy]pentyl]benzamide?
The canonical SMILES for N-[5-[4-[bis(2,3-dihydroxypropyl)amino]phenoxy]pentyl]benzamide is O=C(NCCCCCOc1ccc(N(CC(O)CO)CC(O)CO)cc1)c1ccccc1.
What is the InChIKey of N-[5-[4-[bis(2,3-dihydroxypropyl)amino]phenoxy]pentyl]benzamide?
The InChIKey is RMHRLHWWWNUBLZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H34N2O6/c27-17-21(29)15-26(16-22(30)18-28)20-9-11-23(12-10-20)32-14-6-2-5-13-25-24(31)19-7-3-1-4-8-19/h1,3-4,7-12,21-22,27-30H,2,5-6,13-18H2,(H,25,31).
What are the key properties of N-[5-[4-[bis(2,3-dihydroxypropyl)amino]phenoxy]pentyl]benzamide?
N-[5-[4-[bis(2,3-dihydroxypropyl)amino]phenoxy]pentyl]benzamide has a molecular weight of 446.54 g/mol, XLogP of 1.18, 15 rotatable bonds, 5 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-[5-[4-[bis(2,3-dihydroxypropyl)amino]phenoxy]pentyl]benzamide is sourced from PubChem (CID 3027024), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).