C24H29N5O2S — CID 30270407
1-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)-N-(4-morpholin-4-ylphenyl)piperidine-4-carboxamide (PubChem CID 30270407) has the molecular formula C24H29N5O2S and a molecular weight of 451.60 g/mol. Its IUPAC name is 1-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)-N-(4-morpholin-4-ylphenyl)piperidine-4-carboxamide.
| Compound Name | 1-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)-N-(4-morpholin-4-ylphenyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 30270407 |
| Molecular Formula | C24H29N5O2S |
| Molecular Weight | 451.60 g/mol |
| Exact Mass | 451.20 |
| IUPAC Name | 1-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)-N-(4-morpholin-4-ylphenyl)piperidine-4-carboxamide |
| SMILES | Cc1sc2ncnc(N3CCC(C(=O)Nc4ccc(N5CCOCC5)cc4)CC3)c2c1C |
| InChI | InChI=1S/C24H29N5O2S/c1-16-17(2)32-24-21(16)22(25-15-26-24)29-9-7-18(8-10-29)23(30)27-19-3-5-20(6-4-19)28-11-13-31-14-12-28/h3-6,15,18H,7-14H2,1-2H3,(H,27,30) |
| InChIKey | DEVBWMWYEMJSQL-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.60 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|