About 4-chloro-N,N'-dimethylbenzenecarboximidamide;hydrochloride
4-chloro-N,N'-dimethylbenzenecarboximidamide;hydrochloride (PubChem CID 3027144) has the molecular formula C9H12Cl2N2
and a molecular weight of 219.12 g/mol. Its IUPAC name is 4-chloro-N,N'-dimethylbenzenecarboximidamide;hydrochloride.
Molecular Properties
| Compound Name | 4-chloro-N,N'-dimethylbenzenecarboximidamide;hydrochloride |
| PubChem CID | 3027144 |
| Molecular Formula | C9H12Cl2N2 |
| Molecular Weight | 219.12 g/mol |
| Exact Mass | 218.04 |
| IUPAC Name | 4-chloro-N,N'-dimethylbenzenecarboximidamide;hydrochloride |
| SMILES | C/N=C(\NC)c1ccc(Cl)cc1.Cl |
| InChI | InChI=1S/C9H11ClN2.ClH/c1-11-9(12-2)7-3-5-8(10)6-4-7;/h3-6H,1-2H3,(H,11,12);1H |
| InChIKey | PDLBFUDXXCCCBP-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.12 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-N,N'-dimethylbenzenecarboximidamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-N,N'-dimethylbenzenecarboximidamide;hydrochloride?
The IUPAC name of 4-chloro-N,N'-dimethylbenzenecarboximidamide;hydrochloride (CID 3027144) is 4-chloro-N,N'-dimethylbenzenecarboximidamide;hydrochloride.
What is the SMILES notation for 4-chloro-N,N'-dimethylbenzenecarboximidamide;hydrochloride?
The canonical SMILES for 4-chloro-N,N'-dimethylbenzenecarboximidamide;hydrochloride is C/N=C(\NC)c1ccc(Cl)cc1.Cl.
What is the InChIKey of 4-chloro-N,N'-dimethylbenzenecarboximidamide;hydrochloride?
The InChIKey is PDLBFUDXXCCCBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11ClN2.ClH/c1-11-9(12-2)7-3-5-8(10)6-4-7;/h3-6H,1-2H3,(H,11,12);1H.
What are the key properties of 4-chloro-N,N'-dimethylbenzenecarboximidamide;hydrochloride?
4-chloro-N,N'-dimethylbenzenecarboximidamide;hydrochloride has a molecular weight of 219.12 g/mol, XLogP of 2.36, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-N,N'-dimethylbenzenecarboximidamide;hydrochloride is sourced from PubChem (CID 3027144), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).