About 4-(hydroxymethyl)-N,N-dipropylbenzenesulfonamide
4-(hydroxymethyl)-N,N-dipropylbenzenesulfonamide (PubChem CID 3027298) has the molecular formula C13H21NO3S
and a molecular weight of 271.38 g/mol. Its IUPAC name is 4-(hydroxymethyl)-N,N-dipropylbenzenesulfonamide.
Molecular Properties
| Compound Name | 4-(hydroxymethyl)-N,N-dipropylbenzenesulfonamide |
| PubChem CID | 3027298 |
| Molecular Formula | C13H21NO3S |
| Molecular Weight | 271.38 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | 4-(hydroxymethyl)-N,N-dipropylbenzenesulfonamide |
| SMILES | CCCN(CCC)S(=O)(=O)c1ccc(CO)cc1 |
| InChI | InChI=1S/C13H21NO3S/c1-3-9-14(10-4-2)18(16,17)13-7-5-12(11-15)6-8-13/h5-8,15H,3-4,9-11H2,1-2H3 |
| InChIKey | LZJBCZPLTVAHAC-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.38 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(hydroxymethyl)-N,N-dipropylbenzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(hydroxymethyl)-N,N-dipropylbenzenesulfonamide?
The IUPAC name of 4-(hydroxymethyl)-N,N-dipropylbenzenesulfonamide (CID 3027298) is 4-(hydroxymethyl)-N,N-dipropylbenzenesulfonamide.
What is the SMILES notation for 4-(hydroxymethyl)-N,N-dipropylbenzenesulfonamide?
The canonical SMILES for 4-(hydroxymethyl)-N,N-dipropylbenzenesulfonamide is CCCN(CCC)S(=O)(=O)c1ccc(CO)cc1.
What is the InChIKey of 4-(hydroxymethyl)-N,N-dipropylbenzenesulfonamide?
The InChIKey is LZJBCZPLTVAHAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21NO3S/c1-3-9-14(10-4-2)18(16,17)13-7-5-12(11-15)6-8-13/h5-8,15H,3-4,9-11H2,1-2H3.
What are the key properties of 4-(hydroxymethyl)-N,N-dipropylbenzenesulfonamide?
4-(hydroxymethyl)-N,N-dipropylbenzenesulfonamide has a molecular weight of 271.38 g/mol, XLogP of 1.99, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(hydroxymethyl)-N,N-dipropylbenzenesulfonamide is sourced from PubChem (CID 3027298), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).