C20H27N3O6S2 — CID 30273811
2-[4-(dimethylsulfamoyl)-N-methylsulfonylanilino]-N-[(2-ethoxyphenyl)methyl]acetamide (PubChem CID 30273811) has the molecular formula C20H27N3O6S2 and a molecular weight of 469.59 g/mol. Its IUPAC name is 2-[4-(dimethylsulfamoyl)-N-methylsulfonylanilino]-N-[(2-ethoxyphenyl)methyl]acetamide.
| Compound Name | 2-[4-(dimethylsulfamoyl)-N-methylsulfonylanilino]-N-[(2-ethoxyphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 30273811 |
| Molecular Formula | C20H27N3O6S2 |
| Molecular Weight | 469.59 g/mol |
| Exact Mass | 469.13 |
| IUPAC Name | 2-[4-(dimethylsulfamoyl)-N-methylsulfonylanilino]-N-[(2-ethoxyphenyl)methyl]acetamide |
| SMILES | CCOc1ccccc1CNC(=O)CN(c1ccc(S(=O)(=O)N(C)C)cc1)S(C)(=O)=O |
| InChI | InChI=1S/C20H27N3O6S2/c1-5-29-19-9-7-6-8-16(19)14-21-20(24)15-23(30(4,25)26)17-10-12-18(13-11-17)31(27,28)22(2)3/h6-13H,5,14-15H2,1-4H3,(H,21,24) |
| InChIKey | JTEFUHUFCHEUDU-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 113.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.59 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |