C15H23NO3 — CID 30275
1-[2-[2-(Dimethylamino)ethoxy]-4-methoxyphenyl]butan-1-one (PubChem CID 30275) has the molecular formula C15H23NO3 and a molecular weight of 265.35 g/mol. Its IUPAC name is 1-[2-[2-(dimethylamino)ethoxy]-4-methoxyphenyl]butan-1-one.
| Compound Name | 1-[2-[2-(Dimethylamino)ethoxy]-4-methoxyphenyl]butan-1-one |
|---|---|
| PubChem CID | 30275 |
| Molecular Formula | C15H23NO3 |
| Molecular Weight | 265.35 g/mol |
| Exact Mass | 265.17 |
| IUPAC Name | 1-[2-[2-(dimethylamino)ethoxy]-4-methoxyphenyl]butan-1-one |
| SMILES | CCCC(=O)C1=C(C=C(C=C1)OC)OCCN(C)C |
| InChIKey | DQXSBPLLAKPOLI-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 38.80 Ų |
| H-Bond Donors | 0 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | 268 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.35 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |