C24H26N4O5S — CID 30276150
2-[[2-(3-ethoxy-N-methylsulfonylanilino)acetyl]amino]-N-(pyridin-3-ylmethyl)benzamide (PubChem CID 30276150) has the molecular formula C24H26N4O5S and a molecular weight of 482.56 g/mol. Its IUPAC name is 2-[[2-(3-ethoxy-N-methylsulfonylanilino)acetyl]amino]-N-(pyridin-3-ylmethyl)benzamide.
| Compound Name | 2-[[2-(3-ethoxy-N-methylsulfonylanilino)acetyl]amino]-N-(pyridin-3-ylmethyl)benzamide |
|---|---|
| PubChem CID | 30276150 |
| Molecular Formula | C24H26N4O5S |
| Molecular Weight | 482.56 g/mol |
| Exact Mass | 482.16 |
| IUPAC Name | 2-[[2-(3-ethoxy-N-methylsulfonylanilino)acetyl]amino]-N-(pyridin-3-ylmethyl)benzamide |
| SMILES | CCOc1cccc(N(CC(=O)Nc2ccccc2C(=O)NCc2cccnc2)S(C)(=O)=O)c1 |
| InChI | InChI=1S/C24H26N4O5S/c1-3-33-20-10-6-9-19(14-20)28(34(2,31)32)17-23(29)27-22-12-5-4-11-21(22)24(30)26-16-18-8-7-13-25-15-18/h4-15H,3,16-17H2,1-2H3,(H,26,30)(H,27,29) |
| InChIKey | ZRSOJCHCSNLQBQ-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 117.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.56 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |