C16H26N2O2 — CID 3027706
2-(4-ethoxyanilino)-N,N-diethylbutanamide (PubChem CID 3027706) has the molecular formula C16H26N2O2 and a molecular weight of 278.40 g/mol. Its IUPAC name is 2-(4-ethoxyanilino)-N,N-diethylbutanamide.
| Compound Name | 2-(4-ethoxyanilino)-N,N-diethylbutanamide |
|---|---|
| PubChem CID | 3027706 |
| Molecular Formula | C16H26N2O2 |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.20 |
| IUPAC Name | 2-(4-ethoxyanilino)-N,N-diethylbutanamide |
| SMILES | CCOc1ccc(NC(CC)C(=O)N(CC)CC)cc1 |
| InChI | InChI=1S/C16H26N2O2/c1-5-15(16(19)18(6-2)7-3)17-13-9-11-14(12-10-13)20-8-4/h9-12,15,17H,5-8H2,1-4H3 |
| InChIKey | APRHGFNLIHNOIP-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|