C23H31N3O7S2 — CID 30277449
N-[3-(2-methoxyphenyl)propyl]-2-(N-methylsulfonyl-4-morpholin-4-ylsulfonylanilino)acetamide (PubChem CID 30277449) has the molecular formula C23H31N3O7S2 and a molecular weight of 525.65 g/mol. Its IUPAC name is N-[3-(2-methoxyphenyl)propyl]-2-(N-methylsulfonyl-4-morpholin-4-ylsulfonylanilino)acetamide.
| Compound Name | N-[3-(2-methoxyphenyl)propyl]-2-(N-methylsulfonyl-4-morpholin-4-ylsulfonylanilino)acetamide |
|---|---|
| PubChem CID | 30277449 |
| Molecular Formula | C23H31N3O7S2 |
| Molecular Weight | 525.65 g/mol |
| Exact Mass | 525.16 |
| IUPAC Name | N-[3-(2-methoxyphenyl)propyl]-2-(N-methylsulfonyl-4-morpholin-4-ylsulfonylanilino)acetamide |
| SMILES | COc1ccccc1CCCNC(=O)CN(c1ccc(S(=O)(=O)N2CCOCC2)cc1)S(C)(=O)=O |
| InChI | InChI=1S/C23H31N3O7S2/c1-32-22-8-4-3-6-19(22)7-5-13-24-23(27)18-26(34(2,28)29)20-9-11-21(12-10-20)35(30,31)25-14-16-33-17-15-25/h3-4,6,8-12H,5,7,13-18H2,1-2H3,(H,24,27) |
| InChIKey | DPZVUNCKFYFTKR-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 122.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.65 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|