About 3,3-dimethyl-1-piperidin-1-ylbutan-2-one;hydrobromide
3,3-dimethyl-1-piperidin-1-ylbutan-2-one;hydrobromide (PubChem CID 3027753) has the molecular formula C11H22BrNO
and a molecular weight of 264.21 g/mol. Its IUPAC name is 3,3-dimethyl-1-piperidin-1-ylbutan-2-one;hydrobromide.
Molecular Properties
| Compound Name | 3,3-dimethyl-1-piperidin-1-ylbutan-2-one;hydrobromide |
| PubChem CID | 3027753 |
| Molecular Formula | C11H22BrNO |
| Molecular Weight | 264.21 g/mol |
| Exact Mass | 263.09 |
| IUPAC Name | 3,3-dimethyl-1-piperidin-1-ylbutan-2-one;hydrobromide |
| SMILES | Br.CC(C)(C)C(=O)CN1CCCCC1 |
| InChI | InChI=1S/C11H21NO.BrH/c1-11(2,3)10(13)9-12-7-5-4-6-8-12;/h4-9H2,1-3H3;1H |
| InChIKey | SHDBUTSJOIRPII-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.21 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3,3-dimethyl-1-piperidin-1-ylbutan-2-one;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-dimethyl-1-piperidin-1-ylbutan-2-one;hydrobromide?
The IUPAC name of 3,3-dimethyl-1-piperidin-1-ylbutan-2-one;hydrobromide (CID 3027753) is 3,3-dimethyl-1-piperidin-1-ylbutan-2-one;hydrobromide.
What is the SMILES notation for 3,3-dimethyl-1-piperidin-1-ylbutan-2-one;hydrobromide?
The canonical SMILES for 3,3-dimethyl-1-piperidin-1-ylbutan-2-one;hydrobromide is Br.CC(C)(C)C(=O)CN1CCCCC1.
What is the InChIKey of 3,3-dimethyl-1-piperidin-1-ylbutan-2-one;hydrobromide?
The InChIKey is SHDBUTSJOIRPII-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21NO.BrH/c1-11(2,3)10(13)9-12-7-5-4-6-8-12;/h4-9H2,1-3H3;1H.
What are the key properties of 3,3-dimethyl-1-piperidin-1-ylbutan-2-one;hydrobromide?
3,3-dimethyl-1-piperidin-1-ylbutan-2-one;hydrobromide has a molecular weight of 264.21 g/mol, XLogP of 2.67, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-dimethyl-1-piperidin-1-ylbutan-2-one;hydrobromide is sourced from PubChem (CID 3027753), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).