C19H24ClN2O2- — CID 3027981
N-[2-[2-(diethylamino)ethyl]-3-phenylphenyl]carbamate;hydrochloride (PubChem CID 3027981) has the molecular formula C19H24ClN2O2- and a molecular weight of 347.87 g/mol. Its IUPAC name is N-[2-[2-(diethylamino)ethyl]-3-phenylphenyl]carbamate;hydrochloride.
| Compound Name | N-[2-[2-(diethylamino)ethyl]-3-phenylphenyl]carbamate;hydrochloride |
|---|---|
| PubChem CID | 3027981 |
| Molecular Formula | C19H24ClN2O2- |
| Molecular Weight | 347.87 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | N-[2-[2-(diethylamino)ethyl]-3-phenylphenyl]carbamate;hydrochloride |
| SMILES | CCN(CC)CCc1c(NC(=O)[O-])cccc1-c1ccccc1.Cl |
| InChI | InChI=1S/C19H24N2O2.ClH/c1-3-21(4-2)14-13-17-16(15-9-6-5-7-10-15)11-8-12-18(17)20-19(22)23;/h5-12,20H,3-4,13-14H2,1-2H3,(H,22,23);1H/p-1 |
| InChIKey | QMVNEGDTSWSDSW-UHFFFAOYSA-M |
| XLogP | 3.41 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.87 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |