About N-[4-(3,4-dihydro-2H-thiochromen-8-yloxy)butyl]-N-ethylcyclopentanamine
N-[4-(3,4-dihydro-2H-thiochromen-8-yloxy)butyl]-N-ethylcyclopentanamine (PubChem CID 3028131) has the molecular formula C20H31NOS
and a molecular weight of 333.54 g/mol. Its IUPAC name is N-[4-(3,4-dihydro-2H-thiochromen-8-yloxy)butyl]-N-ethylcyclopentanamine.
Molecular Properties
| Compound Name | N-[4-(3,4-dihydro-2H-thiochromen-8-yloxy)butyl]-N-ethylcyclopentanamine |
| PubChem CID | 3028131 |
| Molecular Formula | C20H31NOS |
| Molecular Weight | 333.54 g/mol |
| Exact Mass | 333.21 |
| IUPAC Name | N-[4-(3,4-dihydro-2H-thiochromen-8-yloxy)butyl]-N-ethylcyclopentanamine |
| SMILES | CCN(CCCCOc1cccc2c1SCCC2)C1CCCC1 |
| InChI | InChI=1S/C20H31NOS/c1-2-21(18-11-3-4-12-18)14-5-6-15-22-19-13-7-9-17-10-8-16-23-20(17)19/h7,9,13,18H,2-6,8,10-12,14-16H2,1H3 |
| InChIKey | SUAABRKCGXFHBW-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 333.54 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[4-(3,4-dihydro-2H-thiochromen-8-yloxy)butyl]-N-ethylcyclopentanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-(3,4-dihydro-2H-thiochromen-8-yloxy)butyl]-N-ethylcyclopentanamine?
The IUPAC name of N-[4-(3,4-dihydro-2H-thiochromen-8-yloxy)butyl]-N-ethylcyclopentanamine (CID 3028131) is N-[4-(3,4-dihydro-2H-thiochromen-8-yloxy)butyl]-N-ethylcyclopentanamine.
What is the SMILES notation for N-[4-(3,4-dihydro-2H-thiochromen-8-yloxy)butyl]-N-ethylcyclopentanamine?
The canonical SMILES for N-[4-(3,4-dihydro-2H-thiochromen-8-yloxy)butyl]-N-ethylcyclopentanamine is CCN(CCCCOc1cccc2c1SCCC2)C1CCCC1.
What is the InChIKey of N-[4-(3,4-dihydro-2H-thiochromen-8-yloxy)butyl]-N-ethylcyclopentanamine?
The InChIKey is SUAABRKCGXFHBW-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H31NOS/c1-2-21(18-11-3-4-12-18)14-5-6-15-22-19-13-7-9-17-10-8-16-23-20(17)19/h7,9,13,18H,2-6,8,10-12,14-16H2,1H3.
What are the key properties of N-[4-(3,4-dihydro-2H-thiochromen-8-yloxy)butyl]-N-ethylcyclopentanamine?
N-[4-(3,4-dihydro-2H-thiochromen-8-yloxy)butyl]-N-ethylcyclopentanamine has a molecular weight of 333.54 g/mol, XLogP of 5.15, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-(3,4-dihydro-2H-thiochromen-8-yloxy)butyl]-N-ethylcyclopentanamine is sourced from PubChem (CID 3028131), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).