C16H18BrFN2O2 — CID 30282098
(E)-3-(5-bromo-2-fluorophenyl)-N-[3-(2-oxopyrrolidin-1-yl)propyl]prop-2-enamide (PubChem CID 30282098) has the molecular formula C16H18BrFN2O2 and a molecular weight of 369.23 g/mol. Its IUPAC name is (E)-3-(5-bromo-2-fluorophenyl)-N-[3-(2-oxopyrrolidin-1-yl)propyl]prop-2-enamide.
| Compound Name | (E)-3-(5-bromo-2-fluorophenyl)-N-[3-(2-oxopyrrolidin-1-yl)propyl]prop-2-enamide |
|---|---|
| PubChem CID | 30282098 |
| Molecular Formula | C16H18BrFN2O2 |
| Molecular Weight | 369.23 g/mol |
| Exact Mass | 368.05 |
| IUPAC Name | (E)-3-(5-bromo-2-fluorophenyl)-N-[3-(2-oxopyrrolidin-1-yl)propyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1cc(Br)ccc1F)NCCCN1CCCC1=O |
| InChI | InChI=1S/C16H18BrFN2O2/c17-13-5-6-14(18)12(11-13)4-7-15(21)19-8-2-10-20-9-1-3-16(20)22/h4-7,11H,1-3,8-10H2,(H,19,21)/b7-4+ |
| InChIKey | OKLXCTRHEPBGBP-QPJJXVBHSA-N |
| XLogP | 2.73 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.23 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|