About 2-(3,4-dihydro-2H-thiochromen-8-yloxy)-N,N-diethylethanamine
2-(3,4-dihydro-2H-thiochromen-8-yloxy)-N,N-diethylethanamine (PubChem CID 3028224) has the molecular formula C15H23NOS
and a molecular weight of 265.42 g/mol. Its IUPAC name is 2-(3,4-dihydro-2H-thiochromen-8-yloxy)-N,N-diethylethanamine.
Molecular Properties
| Compound Name | 2-(3,4-dihydro-2H-thiochromen-8-yloxy)-N,N-diethylethanamine |
| PubChem CID | 3028224 |
| Molecular Formula | C15H23NOS |
| Molecular Weight | 265.42 g/mol |
| Exact Mass | 265.15 |
| IUPAC Name | 2-(3,4-dihydro-2H-thiochromen-8-yloxy)-N,N-diethylethanamine |
| SMILES | CCN(CC)CCOc1cccc2c1SCCC2 |
| InChI | InChI=1S/C15H23NOS/c1-3-16(4-2)10-11-17-14-9-5-7-13-8-6-12-18-15(13)14/h5,7,9H,3-4,6,8,10-12H2,1-2H3 |
| InChIKey | VTVKUEZJOHCWFL-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.42 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(3,4-dihydro-2H-thiochromen-8-yloxy)-N,N-diethylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,4-dihydro-2H-thiochromen-8-yloxy)-N,N-diethylethanamine?
The IUPAC name of 2-(3,4-dihydro-2H-thiochromen-8-yloxy)-N,N-diethylethanamine (CID 3028224) is 2-(3,4-dihydro-2H-thiochromen-8-yloxy)-N,N-diethylethanamine.
What is the SMILES notation for 2-(3,4-dihydro-2H-thiochromen-8-yloxy)-N,N-diethylethanamine?
The canonical SMILES for 2-(3,4-dihydro-2H-thiochromen-8-yloxy)-N,N-diethylethanamine is CCN(CC)CCOc1cccc2c1SCCC2.
What is the InChIKey of 2-(3,4-dihydro-2H-thiochromen-8-yloxy)-N,N-diethylethanamine?
The InChIKey is VTVKUEZJOHCWFL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23NOS/c1-3-16(4-2)10-11-17-14-9-5-7-13-8-6-12-18-15(13)14/h5,7,9H,3-4,6,8,10-12H2,1-2H3.
What are the key properties of 2-(3,4-dihydro-2H-thiochromen-8-yloxy)-N,N-diethylethanamine?
2-(3,4-dihydro-2H-thiochromen-8-yloxy)-N,N-diethylethanamine has a molecular weight of 265.42 g/mol, XLogP of 3.45, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,4-dihydro-2H-thiochromen-8-yloxy)-N,N-diethylethanamine is sourced from PubChem (CID 3028224), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).