About 1-fluoro-2-[2,2,2-trichloro-1-(4-fluorophenyl)ethyl]benzene
1-fluoro-2-[2,2,2-trichloro-1-(4-fluorophenyl)ethyl]benzene (PubChem CID 3028250) has the molecular formula C14H9Cl3F2
and a molecular weight of 321.58 g/mol. Its IUPAC name is 1-fluoro-2-[2,2,2-trichloro-1-(4-fluorophenyl)ethyl]benzene.
Molecular Properties
| Compound Name | 1-fluoro-2-[2,2,2-trichloro-1-(4-fluorophenyl)ethyl]benzene |
| PubChem CID | 3028250 |
| Molecular Formula | C14H9Cl3F2 |
| Molecular Weight | 321.58 g/mol |
| Exact Mass | 319.97 |
| IUPAC Name | 1-fluoro-2-[2,2,2-trichloro-1-(4-fluorophenyl)ethyl]benzene |
| SMILES | Fc1ccc(C(c2ccccc2F)C(Cl)(Cl)Cl)cc1 |
| InChI | InChI=1S/C14H9Cl3F2/c15-14(16,17)13(9-5-7-10(18)8-6-9)11-3-1-2-4-12(11)19/h1-8,13H |
| InChIKey | RKQJIISKWLJIAX-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 321.58 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-fluoro-2-[2,2,2-trichloro-1-(4-fluorophenyl)ethyl]benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-fluoro-2-[2,2,2-trichloro-1-(4-fluorophenyl)ethyl]benzene?
The IUPAC name of 1-fluoro-2-[2,2,2-trichloro-1-(4-fluorophenyl)ethyl]benzene (CID 3028250) is 1-fluoro-2-[2,2,2-trichloro-1-(4-fluorophenyl)ethyl]benzene.
What is the SMILES notation for 1-fluoro-2-[2,2,2-trichloro-1-(4-fluorophenyl)ethyl]benzene?
The canonical SMILES for 1-fluoro-2-[2,2,2-trichloro-1-(4-fluorophenyl)ethyl]benzene is Fc1ccc(C(c2ccccc2F)C(Cl)(Cl)Cl)cc1.
What is the InChIKey of 1-fluoro-2-[2,2,2-trichloro-1-(4-fluorophenyl)ethyl]benzene?
The InChIKey is RKQJIISKWLJIAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H9Cl3F2/c15-14(16,17)13(9-5-7-10(18)8-6-9)11-3-1-2-4-12(11)19/h1-8,13H.
What are the key properties of 1-fluoro-2-[2,2,2-trichloro-1-(4-fluorophenyl)ethyl]benzene?
1-fluoro-2-[2,2,2-trichloro-1-(4-fluorophenyl)ethyl]benzene has a molecular weight of 321.58 g/mol, XLogP of 5.47, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-fluoro-2-[2,2,2-trichloro-1-(4-fluorophenyl)ethyl]benzene is sourced from PubChem (CID 3028250), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).