C20H27NO3 — CID 3028280
2-[3-methoxy-4-(5-phenylpentoxy)anilino]ethanol (PubChem CID 3028280) has the molecular formula C20H27NO3 and a molecular weight of 329.44 g/mol. Its IUPAC name is 2-[3-methoxy-4-(5-phenylpentoxy)anilino]ethanol.
| Compound Name | 2-[3-methoxy-4-(5-phenylpentoxy)anilino]ethanol |
|---|---|
| PubChem CID | 3028280 |
| Molecular Formula | C20H27NO3 |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.20 |
| IUPAC Name | 2-[3-methoxy-4-(5-phenylpentoxy)anilino]ethanol |
| SMILES | COc1cc(NCCO)ccc1OCCCCCc1ccccc1 |
| InChI | InChI=1S/C20H27NO3/c1-23-20-16-18(21-13-14-22)11-12-19(20)24-15-7-3-6-10-17-8-4-2-5-9-17/h2,4-5,8-9,11-12,16,21-22H,3,6-7,10,13-15H2,1H3 |
| InChIKey | KSOCLGIFZCEXAS-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|