About 2-[(4-ethylsulfanylphenyl)-phenylmethyl]sulfanyl-N,N-dimethylethanamine
2-[(4-ethylsulfanylphenyl)-phenylmethyl]sulfanyl-N,N-dimethylethanamine (PubChem CID 3028321) has the molecular formula C19H25NS2
and a molecular weight of 331.55 g/mol. Its IUPAC name is 2-[(4-ethylsulfanylphenyl)-phenylmethyl]sulfanyl-N,N-dimethylethanamine.
Molecular Properties
| Compound Name | 2-[(4-ethylsulfanylphenyl)-phenylmethyl]sulfanyl-N,N-dimethylethanamine |
| PubChem CID | 3028321 |
| Molecular Formula | C19H25NS2 |
| Molecular Weight | 331.55 g/mol |
| Exact Mass | 331.14 |
| IUPAC Name | 2-[(4-ethylsulfanylphenyl)-phenylmethyl]sulfanyl-N,N-dimethylethanamine |
| SMILES | CCSc1ccc(C(SCCN(C)C)c2ccccc2)cc1 |
| InChI | InChI=1S/C19H25NS2/c1-4-21-18-12-10-17(11-13-18)19(22-15-14-20(2)3)16-8-6-5-7-9-16/h5-13,19H,4,14-15H2,1-3H3 |
| InChIKey | KBTSAVCDTJERLK-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 331.55 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[(4-ethylsulfanylphenyl)-phenylmethyl]sulfanyl-N,N-dimethylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4-ethylsulfanylphenyl)-phenylmethyl]sulfanyl-N,N-dimethylethanamine?
The IUPAC name of 2-[(4-ethylsulfanylphenyl)-phenylmethyl]sulfanyl-N,N-dimethylethanamine (CID 3028321) is 2-[(4-ethylsulfanylphenyl)-phenylmethyl]sulfanyl-N,N-dimethylethanamine.
What is the SMILES notation for 2-[(4-ethylsulfanylphenyl)-phenylmethyl]sulfanyl-N,N-dimethylethanamine?
The canonical SMILES for 2-[(4-ethylsulfanylphenyl)-phenylmethyl]sulfanyl-N,N-dimethylethanamine is CCSc1ccc(C(SCCN(C)C)c2ccccc2)cc1.
What is the InChIKey of 2-[(4-ethylsulfanylphenyl)-phenylmethyl]sulfanyl-N,N-dimethylethanamine?
The InChIKey is KBTSAVCDTJERLK-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H25NS2/c1-4-21-18-12-10-17(11-13-18)19(22-15-14-20(2)3)16-8-6-5-7-9-16/h5-13,19H,4,14-15H2,1-3H3.
What are the key properties of 2-[(4-ethylsulfanylphenyl)-phenylmethyl]sulfanyl-N,N-dimethylethanamine?
2-[(4-ethylsulfanylphenyl)-phenylmethyl]sulfanyl-N,N-dimethylethanamine has a molecular weight of 331.55 g/mol, XLogP of 5.18, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4-ethylsulfanylphenyl)-phenylmethyl]sulfanyl-N,N-dimethylethanamine is sourced from PubChem (CID 3028321), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).