About 2-propyl-N'-(2-propylpentanoyl)pentanehydrazide
2-propyl-N'-(2-propylpentanoyl)pentanehydrazide (PubChem CID 3028718) has the molecular formula C16H32N2O2
and a molecular weight of 284.44 g/mol. Its IUPAC name is 2-propyl-N'-(2-propylpentanoyl)pentanehydrazide.
Molecular Properties
| Compound Name | 2-propyl-N'-(2-propylpentanoyl)pentanehydrazide |
| PubChem CID | 3028718 |
| Molecular Formula | C16H32N2O2 |
| Molecular Weight | 284.44 g/mol |
| Exact Mass | 284.25 |
| IUPAC Name | 2-propyl-N'-(2-propylpentanoyl)pentanehydrazide |
| SMILES | CCCC(CCC)C(=O)NNC(=O)C(CCC)CCC |
| InChI | InChI=1S/C16H32N2O2/c1-5-9-13(10-6-2)15(19)17-18-16(20)14(11-7-3)12-8-4/h13-14H,5-12H2,1-4H3,(H,17,19)(H,18,20) |
| InChIKey | DSCNZBHQNJVECM-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.44 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-propyl-N'-(2-propylpentanoyl)pentanehydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-propyl-N'-(2-propylpentanoyl)pentanehydrazide?
The IUPAC name of 2-propyl-N'-(2-propylpentanoyl)pentanehydrazide (CID 3028718) is 2-propyl-N'-(2-propylpentanoyl)pentanehydrazide.
What is the SMILES notation for 2-propyl-N'-(2-propylpentanoyl)pentanehydrazide?
The canonical SMILES for 2-propyl-N'-(2-propylpentanoyl)pentanehydrazide is CCCC(CCC)C(=O)NNC(=O)C(CCC)CCC.
What is the InChIKey of 2-propyl-N'-(2-propylpentanoyl)pentanehydrazide?
The InChIKey is DSCNZBHQNJVECM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H32N2O2/c1-5-9-13(10-6-2)15(19)17-18-16(20)14(11-7-3)12-8-4/h13-14H,5-12H2,1-4H3,(H,17,19)(H,18,20).
What are the key properties of 2-propyl-N'-(2-propylpentanoyl)pentanehydrazide?
2-propyl-N'-(2-propylpentanoyl)pentanehydrazide has a molecular weight of 284.44 g/mol, XLogP of 3.57, 10 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propyl-N'-(2-propylpentanoyl)pentanehydrazide is sourced from PubChem (CID 3028718), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).