About 1-butyl-2H-indazol-3-one
1-butyl-2H-indazol-3-one (PubChem CID 3028895) has the molecular formula C11H14N2O
and a molecular weight of 190.25 g/mol. Its IUPAC name is 1-butyl-2H-indazol-3-one.
Molecular Properties
| Compound Name | 1-butyl-2H-indazol-3-one |
| PubChem CID | 3028895 |
| Molecular Formula | C11H14N2O |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.11 |
| IUPAC Name | 1-butyl-2H-indazol-3-one |
| SMILES | CCCCn1[nH]c(=O)c2ccccc21 |
| InChI | InChI=1S/C11H14N2O/c1-2-3-8-13-10-7-5-4-6-9(10)11(14)12-13/h4-7H,2-3,8H2,1H3,(H,12,14) |
| InChIKey | BXHOZCPNWNNOLA-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 37.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-butyl-2H-indazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butyl-2H-indazol-3-one?
The IUPAC name of 1-butyl-2H-indazol-3-one (CID 3028895) is 1-butyl-2H-indazol-3-one.
What is the SMILES notation for 1-butyl-2H-indazol-3-one?
The canonical SMILES for 1-butyl-2H-indazol-3-one is CCCCn1[nH]c(=O)c2ccccc21.
What is the InChIKey of 1-butyl-2H-indazol-3-one?
The InChIKey is BXHOZCPNWNNOLA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N2O/c1-2-3-8-13-10-7-5-4-6-9(10)11(14)12-13/h4-7H,2-3,8H2,1H3,(H,12,14).
What are the key properties of 1-butyl-2H-indazol-3-one?
1-butyl-2H-indazol-3-one has a molecular weight of 190.25 g/mol, XLogP of 2.13, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butyl-2H-indazol-3-one is sourced from PubChem (CID 3028895), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).