C19H13ClN2O4 — CID 3028978
2-[1-(3-chloro-4-methylphenyl)-2,5-dioxopyrrolidin-3-yl]isoindole-1,3-dione (PubChem CID 3028978) has the molecular formula C19H13ClN2O4 and a molecular weight of 368.78 g/mol. Its IUPAC name is 2-[1-(3-chloro-4-methylphenyl)-2,5-dioxopyrrolidin-3-yl]isoindole-1,3-dione.
| Compound Name | 2-[1-(3-chloro-4-methylphenyl)-2,5-dioxopyrrolidin-3-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 3028978 |
| Molecular Formula | C19H13ClN2O4 |
| Molecular Weight | 368.78 g/mol |
| Exact Mass | 368.06 |
| IUPAC Name | 2-[1-(3-chloro-4-methylphenyl)-2,5-dioxopyrrolidin-3-yl]isoindole-1,3-dione |
| SMILES | Cc1ccc(N2C(=O)CC(N3C(=O)c4ccccc4C3=O)C2=O)cc1Cl |
| InChI | InChI=1S/C19H13ClN2O4/c1-10-6-7-11(8-14(10)20)21-16(23)9-15(19(21)26)22-17(24)12-4-2-3-5-13(12)18(22)25/h2-8,15H,9H2,1H3 |
| InChIKey | XVJUKAJELIUULP-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.78 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|