About ethyl N-(2-methyl-4-phenyl-3,4-dihydro-1H-isoquinolin-8-yl)carbamate
ethyl N-(2-methyl-4-phenyl-3,4-dihydro-1H-isoquinolin-8-yl)carbamate (PubChem CID 3029034) has the molecular formula C19H22N2O2
and a molecular weight of 310.40 g/mol. Its IUPAC name is ethyl N-(2-methyl-4-phenyl-3,4-dihydro-1H-isoquinolin-8-yl)carbamate.
Molecular Properties
| Compound Name | ethyl N-(2-methyl-4-phenyl-3,4-dihydro-1H-isoquinolin-8-yl)carbamate |
| PubChem CID | 3029034 |
| Molecular Formula | C19H22N2O2 |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | ethyl N-(2-methyl-4-phenyl-3,4-dihydro-1H-isoquinolin-8-yl)carbamate |
| SMILES | CCOC(=O)Nc1cccc2c1CN(C)CC2c1ccccc1 |
| InChI | InChI=1S/C19H22N2O2/c1-3-23-19(22)20-18-11-7-10-15-16(12-21(2)13-17(15)18)14-8-5-4-6-9-14/h4-11,16H,3,12-13H2,1-2H3,(H,20,22) |
| InChIKey | FQPXAXLGKPKAMF-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethyl N-(2-methyl-4-phenyl-3,4-dihydro-1H-isoquinolin-8-yl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl N-(2-methyl-4-phenyl-3,4-dihydro-1H-isoquinolin-8-yl)carbamate?
The IUPAC name of ethyl N-(2-methyl-4-phenyl-3,4-dihydro-1H-isoquinolin-8-yl)carbamate (CID 3029034) is ethyl N-(2-methyl-4-phenyl-3,4-dihydro-1H-isoquinolin-8-yl)carbamate.
What is the SMILES notation for ethyl N-(2-methyl-4-phenyl-3,4-dihydro-1H-isoquinolin-8-yl)carbamate?
The canonical SMILES for ethyl N-(2-methyl-4-phenyl-3,4-dihydro-1H-isoquinolin-8-yl)carbamate is CCOC(=O)Nc1cccc2c1CN(C)CC2c1ccccc1.
What is the InChIKey of ethyl N-(2-methyl-4-phenyl-3,4-dihydro-1H-isoquinolin-8-yl)carbamate?
The InChIKey is FQPXAXLGKPKAMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22N2O2/c1-3-23-19(22)20-18-11-7-10-15-16(12-21(2)13-17(15)18)14-8-5-4-6-9-14/h4-11,16H,3,12-13H2,1-2H3,(H,20,22).
What are the key properties of ethyl N-(2-methyl-4-phenyl-3,4-dihydro-1H-isoquinolin-8-yl)carbamate?
ethyl N-(2-methyl-4-phenyl-3,4-dihydro-1H-isoquinolin-8-yl)carbamate has a molecular weight of 310.40 g/mol, XLogP of 3.83, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl N-(2-methyl-4-phenyl-3,4-dihydro-1H-isoquinolin-8-yl)carbamate is sourced from PubChem (CID 3029034), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).