About 2-[(2,4-dibromo-6-chlorophenyl)diazenyl]propanedinitrile
2-[(2,4-dibromo-6-chlorophenyl)diazenyl]propanedinitrile (PubChem CID 3029220) has the molecular formula C9H3Br2ClN4
and a molecular weight of 362.41 g/mol. Its IUPAC name is 2-[(2,4-dibromo-6-chlorophenyl)diazenyl]propanedinitrile.
Molecular Properties
| Compound Name | 2-[(2,4-dibromo-6-chlorophenyl)diazenyl]propanedinitrile |
| PubChem CID | 3029220 |
| Molecular Formula | C9H3Br2ClN4 |
| Molecular Weight | 362.41 g/mol |
| Exact Mass | 359.84 |
| IUPAC Name | 2-[(2,4-dibromo-6-chlorophenyl)diazenyl]propanedinitrile |
| SMILES | N#CC(C#N)/N=N/c1c(Cl)cc(Br)cc1Br |
| InChI | InChI=1S/C9H3Br2ClN4/c10-5-1-7(11)9(8(12)2-5)16-15-6(3-13)4-14/h1-2,6H/b16-15+ |
| InChIKey | CQLHVAVDASQLRW-FOCLMDBBSA-N |
| XLogP | 4.36 |
| TPSA | 72.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.41 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze 2-[(2,4-dibromo-6-chlorophenyl)diazenyl]propanedinitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2,4-dibromo-6-chlorophenyl)diazenyl]propanedinitrile?
The IUPAC name of 2-[(2,4-dibromo-6-chlorophenyl)diazenyl]propanedinitrile (CID 3029220) is 2-[(2,4-dibromo-6-chlorophenyl)diazenyl]propanedinitrile.
What is the SMILES notation for 2-[(2,4-dibromo-6-chlorophenyl)diazenyl]propanedinitrile?
The canonical SMILES for 2-[(2,4-dibromo-6-chlorophenyl)diazenyl]propanedinitrile is N#CC(C#N)/N=N/c1c(Cl)cc(Br)cc1Br.
What is the InChIKey of 2-[(2,4-dibromo-6-chlorophenyl)diazenyl]propanedinitrile?
The InChIKey is CQLHVAVDASQLRW-FOCLMDBBSA-N. The full InChI is InChI=1S/C9H3Br2ClN4/c10-5-1-7(11)9(8(12)2-5)16-15-6(3-13)4-14/h1-2,6H/b16-15+.
What are the key properties of 2-[(2,4-dibromo-6-chlorophenyl)diazenyl]propanedinitrile?
2-[(2,4-dibromo-6-chlorophenyl)diazenyl]propanedinitrile has a molecular weight of 362.41 g/mol, XLogP of 4.36, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2,4-dibromo-6-chlorophenyl)diazenyl]propanedinitrile is sourced from PubChem (CID 3029220), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).