C20H42Cl2N2 — CID 3029604
N,N'-dicyclohexyloctane-1,8-diamine;dihydrochloride (PubChem CID 3029604) has the molecular formula C20H42Cl2N2 and a molecular weight of 381.48 g/mol. Its IUPAC name is N,N'-dicyclohexyloctane-1,8-diamine;dihydrochloride.
| Compound Name | N,N'-dicyclohexyloctane-1,8-diamine;dihydrochloride |
|---|---|
| PubChem CID | 3029604 |
| Molecular Formula | C20H42Cl2N2 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 380.27 |
| IUPAC Name | N,N'-dicyclohexyloctane-1,8-diamine;dihydrochloride |
| SMILES | C(CCCCNC1CCCCC1)CCCNC1CCCCC1.Cl.Cl |
| InChI | InChI=1S/C20H40N2.2ClH/c1(3-11-17-21-19-13-7-5-8-14-19)2-4-12-18-22-20-15-9-6-10-16-20;;/h19-22H,1-18H2;2*1H |
| InChIKey | LBVBXYBGVMKRCT-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|