About 2-ethyl-5-methyl-3-nitroso-1,3-oxazolidine
2-ethyl-5-methyl-3-nitroso-1,3-oxazolidine (PubChem CID 3029678) has the molecular formula C6H12N2O2
and a molecular weight of 144.17 g/mol. Its IUPAC name is 2-ethyl-5-methyl-3-nitroso-1,3-oxazolidine.
Molecular Properties
| Compound Name | 2-ethyl-5-methyl-3-nitroso-1,3-oxazolidine |
| PubChem CID | 3029678 |
| Molecular Formula | C6H12N2O2 |
| Molecular Weight | 144.17 g/mol |
| Exact Mass | 144.09 |
| IUPAC Name | 2-ethyl-5-methyl-3-nitroso-1,3-oxazolidine |
| SMILES | CCC1OC(C)CN1N=O |
| InChI | InChI=1S/C6H12N2O2/c1-3-6-8(7-9)4-5(2)10-6/h5-6H,3-4H2,1-2H3 |
| InChIKey | MGWMSESWDVZKRI-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.17 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-nitroso', 'substructure': 'N/A'} |
|---|
Analyze 2-ethyl-5-methyl-3-nitroso-1,3-oxazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-5-methyl-3-nitroso-1,3-oxazolidine?
The IUPAC name of 2-ethyl-5-methyl-3-nitroso-1,3-oxazolidine (CID 3029678) is 2-ethyl-5-methyl-3-nitroso-1,3-oxazolidine.
What is the SMILES notation for 2-ethyl-5-methyl-3-nitroso-1,3-oxazolidine?
The canonical SMILES for 2-ethyl-5-methyl-3-nitroso-1,3-oxazolidine is CCC1OC(C)CN1N=O.
What is the InChIKey of 2-ethyl-5-methyl-3-nitroso-1,3-oxazolidine?
The InChIKey is MGWMSESWDVZKRI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N2O2/c1-3-6-8(7-9)4-5(2)10-6/h5-6H,3-4H2,1-2H3.
What are the key properties of 2-ethyl-5-methyl-3-nitroso-1,3-oxazolidine?
2-ethyl-5-methyl-3-nitroso-1,3-oxazolidine has a molecular weight of 144.17 g/mol, XLogP of 1.12, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-5-methyl-3-nitroso-1,3-oxazolidine is sourced from PubChem (CID 3029678), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).