About 5-(dimethylamino)-1,2-diphenylpentan-3-one;hydrochloride
5-(dimethylamino)-1,2-diphenylpentan-3-one;hydrochloride (PubChem CID 3029725) has the molecular formula C19H24ClNO
and a molecular weight of 317.86 g/mol. Its IUPAC name is 5-(dimethylamino)-1,2-diphenylpentan-3-one;hydrochloride.
Molecular Properties
| Compound Name | 5-(dimethylamino)-1,2-diphenylpentan-3-one;hydrochloride |
| PubChem CID | 3029725 |
| Molecular Formula | C19H24ClNO |
| Molecular Weight | 317.86 g/mol |
| Exact Mass | 317.15 |
| IUPAC Name | 5-(dimethylamino)-1,2-diphenylpentan-3-one;hydrochloride |
| SMILES | CN(C)CCC(=O)C(Cc1ccccc1)c1ccccc1.Cl |
| InChI | InChI=1S/C19H23NO.ClH/c1-20(2)14-13-19(21)18(17-11-7-4-8-12-17)15-16-9-5-3-6-10-16;/h3-12,18H,13-15H2,1-2H3;1H |
| InChIKey | RBUZBRMFALWQMK-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.86 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-(dimethylamino)-1,2-diphenylpentan-3-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(dimethylamino)-1,2-diphenylpentan-3-one;hydrochloride?
The IUPAC name of 5-(dimethylamino)-1,2-diphenylpentan-3-one;hydrochloride (CID 3029725) is 5-(dimethylamino)-1,2-diphenylpentan-3-one;hydrochloride.
What is the SMILES notation for 5-(dimethylamino)-1,2-diphenylpentan-3-one;hydrochloride?
The canonical SMILES for 5-(dimethylamino)-1,2-diphenylpentan-3-one;hydrochloride is CN(C)CCC(=O)C(Cc1ccccc1)c1ccccc1.Cl.
What is the InChIKey of 5-(dimethylamino)-1,2-diphenylpentan-3-one;hydrochloride?
The InChIKey is RBUZBRMFALWQMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H23NO.ClH/c1-20(2)14-13-19(21)18(17-11-7-4-8-12-17)15-16-9-5-3-6-10-16;/h3-12,18H,13-15H2,1-2H3;1H.
What are the key properties of 5-(dimethylamino)-1,2-diphenylpentan-3-one;hydrochloride?
5-(dimethylamino)-1,2-diphenylpentan-3-one;hydrochloride has a molecular weight of 317.86 g/mol, XLogP of 3.96, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(dimethylamino)-1,2-diphenylpentan-3-one;hydrochloride is sourced from PubChem (CID 3029725), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).