About 4-[(3,4-dimethoxyphenyl)methyl]-2-piperazin-1-yl-1,3-thiazole
4-[(3,4-dimethoxyphenyl)methyl]-2-piperazin-1-yl-1,3-thiazole (PubChem CID 3030139) has the molecular formula C16H21N3O2S
and a molecular weight of 319.43 g/mol. Its IUPAC name is 4-[(3,4-dimethoxyphenyl)methyl]-2-piperazin-1-yl-1,3-thiazole.
Molecular Properties
| Compound Name | 4-[(3,4-dimethoxyphenyl)methyl]-2-piperazin-1-yl-1,3-thiazole |
| PubChem CID | 3030139 |
| Molecular Formula | C16H21N3O2S |
| Molecular Weight | 319.43 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | 4-[(3,4-dimethoxyphenyl)methyl]-2-piperazin-1-yl-1,3-thiazole |
| SMILES | COc1ccc(Cc2csc(N3CCNCC3)n2)cc1OC |
| InChI | InChI=1S/C16H21N3O2S/c1-20-14-4-3-12(10-15(14)21-2)9-13-11-22-16(18-13)19-7-5-17-6-8-19/h3-4,10-11,17H,5-9H2,1-2H3 |
| InChIKey | PCSRXQVADQEFIJ-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 46.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.43 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-[(3,4-dimethoxyphenyl)methyl]-2-piperazin-1-yl-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(3,4-dimethoxyphenyl)methyl]-2-piperazin-1-yl-1,3-thiazole?
The IUPAC name of 4-[(3,4-dimethoxyphenyl)methyl]-2-piperazin-1-yl-1,3-thiazole (CID 3030139) is 4-[(3,4-dimethoxyphenyl)methyl]-2-piperazin-1-yl-1,3-thiazole.
What is the SMILES notation for 4-[(3,4-dimethoxyphenyl)methyl]-2-piperazin-1-yl-1,3-thiazole?
The canonical SMILES for 4-[(3,4-dimethoxyphenyl)methyl]-2-piperazin-1-yl-1,3-thiazole is COc1ccc(Cc2csc(N3CCNCC3)n2)cc1OC.
What is the InChIKey of 4-[(3,4-dimethoxyphenyl)methyl]-2-piperazin-1-yl-1,3-thiazole?
The InChIKey is PCSRXQVADQEFIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21N3O2S/c1-20-14-4-3-12(10-15(14)21-2)9-13-11-22-16(18-13)19-7-5-17-6-8-19/h3-4,10-11,17H,5-9H2,1-2H3.
What are the key properties of 4-[(3,4-dimethoxyphenyl)methyl]-2-piperazin-1-yl-1,3-thiazole?
4-[(3,4-dimethoxyphenyl)methyl]-2-piperazin-1-yl-1,3-thiazole has a molecular weight of 319.43 g/mol, XLogP of 2.16, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(3,4-dimethoxyphenyl)methyl]-2-piperazin-1-yl-1,3-thiazole is sourced from PubChem (CID 3030139), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).