C23H23FN2O4S — CID 30304312
2-[N-(benzenesulfonyl)-4-methoxyanilino]-N-[(1R)-1-(4-fluorophenyl)ethyl]acetamide (PubChem CID 30304312) has the molecular formula C23H23FN2O4S and a molecular weight of 442.51 g/mol. Its IUPAC name is 2-[N-(benzenesulfonyl)-4-methoxyanilino]-N-[(1R)-1-(4-fluorophenyl)ethyl]acetamide.
| Compound Name | 2-[N-(benzenesulfonyl)-4-methoxyanilino]-N-[(1R)-1-(4-fluorophenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 30304312 |
| Molecular Formula | C23H23FN2O4S |
| Molecular Weight | 442.51 g/mol |
| Exact Mass | 442.14 |
| IUPAC Name | 2-[N-(benzenesulfonyl)-4-methoxyanilino]-N-[(1R)-1-(4-fluorophenyl)ethyl]acetamide |
| SMILES | COc1ccc(N(CC(=O)N[C@H](C)c2ccc(F)cc2)S(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C23H23FN2O4S/c1-17(18-8-10-19(24)11-9-18)25-23(27)16-26(20-12-14-21(30-2)15-13-20)31(28,29)22-6-4-3-5-7-22/h3-15,17H,16H2,1-2H3,(H,25,27)/t17-/m1/s1 |
| InChIKey | GYLZRYHITOHDKL-QGZVFWFLSA-N |
| XLogP | 3.91 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.51 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |