C30H30N2O4S — CID 30304449
2-[N-(benzenesulfonyl)-4-ethoxyanilino]-N-[(R)-(2-methylphenyl)-phenylmethyl]acetamide (PubChem CID 30304449) has the molecular formula C30H30N2O4S and a molecular weight of 514.65 g/mol. Its IUPAC name is 2-[N-(benzenesulfonyl)-4-ethoxyanilino]-N-[(R)-(2-methylphenyl)-phenylmethyl]acetamide.
| Compound Name | 2-[N-(benzenesulfonyl)-4-ethoxyanilino]-N-[(R)-(2-methylphenyl)-phenylmethyl]acetamide |
|---|---|
| PubChem CID | 30304449 |
| Molecular Formula | C30H30N2O4S |
| Molecular Weight | 514.65 g/mol |
| Exact Mass | 514.19 |
| IUPAC Name | 2-[N-(benzenesulfonyl)-4-ethoxyanilino]-N-[(R)-(2-methylphenyl)-phenylmethyl]acetamide |
| SMILES | CCOc1ccc(N(CC(=O)N[C@H](c2ccccc2)c2ccccc2C)S(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C30H30N2O4S/c1-3-36-26-20-18-25(19-21-26)32(37(34,35)27-15-8-5-9-16-27)22-29(33)31-30(24-13-6-4-7-14-24)28-17-11-10-12-23(28)2/h4-21,30H,3,22H2,1-2H3,(H,31,33)/t30-/m1/s1 |
| InChIKey | MCMKAJNFKDDJPV-SSEXGKCCSA-N |
| XLogP | 5.49 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.65 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |