C19H31NO4S — CID 3030451
1-(3-acetylsulfanylpropanoyl)-6-(2-cyclohexylethyl)piperidine-2-carboxylic acid (PubChem CID 3030451) has the molecular formula C19H31NO4S and a molecular weight of 369.53 g/mol. Its IUPAC name is 1-(3-acetylsulfanylpropanoyl)-6-(2-cyclohexylethyl)piperidine-2-carboxylic acid.
| Compound Name | 1-(3-acetylsulfanylpropanoyl)-6-(2-cyclohexylethyl)piperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 3030451 |
| Molecular Formula | C19H31NO4S |
| Molecular Weight | 369.53 g/mol |
| Exact Mass | 369.20 |
| IUPAC Name | 1-(3-acetylsulfanylpropanoyl)-6-(2-cyclohexylethyl)piperidine-2-carboxylic acid |
| SMILES | CC(=O)SCCC(=O)N1C(CCC2CCCCC2)CCCC1C(=O)O |
| InChI | InChI=1S/C19H31NO4S/c1-14(21)25-13-12-18(22)20-16(8-5-9-17(20)19(23)24)11-10-15-6-3-2-4-7-15/h15-17H,2-13H2,1H3,(H,23,24) |
| InChIKey | GSHUAJLXXXRTDO-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.53 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|