C25H26Cl2N2O3S — CID 30305612
2-[N-(benzenesulfonyl)-3,4-dichloroanilino]-N-[(1R)-3-methyl-1-phenylbutyl]acetamide (PubChem CID 30305612) has the molecular formula C25H26Cl2N2O3S and a molecular weight of 505.47 g/mol. Its IUPAC name is 2-[N-(benzenesulfonyl)-3,4-dichloroanilino]-N-[(1R)-3-methyl-1-phenylbutyl]acetamide.
| Compound Name | 2-[N-(benzenesulfonyl)-3,4-dichloroanilino]-N-[(1R)-3-methyl-1-phenylbutyl]acetamide |
|---|---|
| PubChem CID | 30305612 |
| Molecular Formula | C25H26Cl2N2O3S |
| Molecular Weight | 505.47 g/mol |
| Exact Mass | 504.10 |
| IUPAC Name | 2-[N-(benzenesulfonyl)-3,4-dichloroanilino]-N-[(1R)-3-methyl-1-phenylbutyl]acetamide |
| SMILES | CC(C)C[C@@H](NC(=O)CN(c1ccc(Cl)c(Cl)c1)S(=O)(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H26Cl2N2O3S/c1-18(2)15-24(19-9-5-3-6-10-19)28-25(30)17-29(20-13-14-22(26)23(27)16-20)33(31,32)21-11-7-4-8-12-21/h3-14,16,18,24H,15,17H2,1-2H3,(H,28,30)/t24-/m1/s1 |
| InChIKey | KSSSZTJUZZXWRL-XMMPIXPASA-N |
| XLogP | 6.09 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.47 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |