C25H28N2O4S2 — CID 30306819
2-(4-ethoxy-N-(4-methylphenyl)sulfonylanilino)-N-(2-ethylsulfanylphenyl)acetamide (PubChem CID 30306819) has the molecular formula C25H28N2O4S2 and a molecular weight of 484.64 g/mol. Its IUPAC name is 2-(4-ethoxy-N-(4-methylphenyl)sulfonylanilino)-N-(2-ethylsulfanylphenyl)acetamide.
| Compound Name | 2-(4-ethoxy-N-(4-methylphenyl)sulfonylanilino)-N-(2-ethylsulfanylphenyl)acetamide |
|---|---|
| PubChem CID | 30306819 |
| Molecular Formula | C25H28N2O4S2 |
| Molecular Weight | 484.64 g/mol |
| Exact Mass | 484.15 |
| IUPAC Name | 2-(4-ethoxy-N-(4-methylphenyl)sulfonylanilino)-N-(2-ethylsulfanylphenyl)acetamide |
| SMILES | CCOc1ccc(N(CC(=O)Nc2ccccc2SCC)S(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C25H28N2O4S2/c1-4-31-21-14-12-20(13-15-21)27(33(29,30)22-16-10-19(3)11-17-22)18-25(28)26-23-8-6-7-9-24(23)32-5-2/h6-17H,4-5,18H2,1-3H3,(H,26,28) |
| InChIKey | JAZCVVIQZXRZGX-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.64 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |