C22H28F2N4O5 — CID 30307006
[2-[(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-pentylamino]-2-oxoethyl] 3,4-difluorobenzoate (PubChem CID 30307006) has the molecular formula C22H28F2N4O5 and a molecular weight of 466.49 g/mol. Its IUPAC name is [2-[(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-pentylamino]-2-oxoethyl] 3,4-difluorobenzoate.
| Compound Name | [2-[(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-pentylamino]-2-oxoethyl] 3,4-difluorobenzoate |
|---|---|
| PubChem CID | 30307006 |
| Molecular Formula | C22H28F2N4O5 |
| Molecular Weight | 466.49 g/mol |
| Exact Mass | 466.20 |
| IUPAC Name | [2-[(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-pentylamino]-2-oxoethyl] 3,4-difluorobenzoate |
| SMILES | CCCCCN(C(=O)COC(=O)c1ccc(F)c(F)c1)c1c(N)n(CCCC)c(=O)[nH]c1=O |
| InChI | InChI=1S/C22H28F2N4O5/c1-3-5-7-11-27(18-19(25)28(10-6-4-2)22(32)26-20(18)30)17(29)13-33-21(31)14-8-9-15(23)16(24)12-14/h8-9,12H,3-7,10-11,13,25H2,1-2H3,(H,26,30,32) |
| InChIKey | SEKUKIXQMNEWEC-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 127.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.49 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|