C13H27NO — CID 3030741
1,4-dibutylpiperidin-4-ol (PubChem CID 3030741) has the molecular formula C13H27NO and a molecular weight of 213.36 g/mol. Its IUPAC name is 1,4-dibutylpiperidin-4-ol.
| Compound Name | 1,4-dibutylpiperidin-4-ol |
|---|---|
| PubChem CID | 3030741 |
| Molecular Formula | C13H27NO |
| Molecular Weight | 213.36 g/mol |
| Exact Mass | 213.21 |
| IUPAC Name | 1,4-dibutylpiperidin-4-ol |
| SMILES | CCCCN1CCC(O)(CCCC)CC1 |
| InChI | InChI=1S/C13H27NO/c1-3-5-7-13(15)8-11-14(12-9-13)10-6-4-2/h15H,3-12H2,1-2H3 |
| InChIKey | TYUVRRNSIUZROH-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.36 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |