About 1,4-dibutylpiperidin-4-ol
1,4-dibutylpiperidin-4-ol (PubChem CID 3030741) has the molecular formula C13H27NO
and a molecular weight of 213.36 g/mol. Its IUPAC name is 1,4-dibutylpiperidin-4-ol.
Molecular Properties
| Compound Name | 1,4-dibutylpiperidin-4-ol |
| PubChem CID | 3030741 |
| Molecular Formula | C13H27NO |
| Molecular Weight | 213.36 g/mol |
| Exact Mass | 213.21 |
| IUPAC Name | 1,4-dibutylpiperidin-4-ol |
| SMILES | CCCCN1CCC(O)(CCCC)CC1 |
| InChI | InChI=1S/C13H27NO/c1-3-5-7-13(15)8-11-14(12-9-13)10-6-4-2/h15H,3-12H2,1-2H3 |
| InChIKey | TYUVRRNSIUZROH-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.36 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,4-dibutylpiperidin-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-dibutylpiperidin-4-ol?
The IUPAC name of 1,4-dibutylpiperidin-4-ol (CID 3030741) is 1,4-dibutylpiperidin-4-ol.
What is the SMILES notation for 1,4-dibutylpiperidin-4-ol?
The canonical SMILES for 1,4-dibutylpiperidin-4-ol is CCCCN1CCC(O)(CCCC)CC1.
What is the InChIKey of 1,4-dibutylpiperidin-4-ol?
The InChIKey is TYUVRRNSIUZROH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H27NO/c1-3-5-7-13(15)8-11-14(12-9-13)10-6-4-2/h15H,3-12H2,1-2H3.
What are the key properties of 1,4-dibutylpiperidin-4-ol?
1,4-dibutylpiperidin-4-ol has a molecular weight of 213.36 g/mol, XLogP of 2.80, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-dibutylpiperidin-4-ol is sourced from PubChem (CID 3030741), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).