About (1-methyl-3-phenylpiperidin-4-yl) 3-methoxypropanoate
(1-methyl-3-phenylpiperidin-4-yl) 3-methoxypropanoate (PubChem CID 3030759) has the molecular formula C16H23NO3
and a molecular weight of 277.36 g/mol. Its IUPAC name is (1-methyl-3-phenylpiperidin-4-yl) 3-methoxypropanoate.
Molecular Properties
| Compound Name | (1-methyl-3-phenylpiperidin-4-yl) 3-methoxypropanoate |
| PubChem CID | 3030759 |
| Molecular Formula | C16H23NO3 |
| Molecular Weight | 277.36 g/mol |
| Exact Mass | 277.17 |
| IUPAC Name | (1-methyl-3-phenylpiperidin-4-yl) 3-methoxypropanoate |
| SMILES | COCCC(=O)OC1CCN(C)CC1c1ccccc1 |
| InChI | InChI=1S/C16H23NO3/c1-17-10-8-15(20-16(18)9-11-19-2)14(12-17)13-6-4-3-5-7-13/h3-7,14-15H,8-12H2,1-2H3 |
| InChIKey | XXBPAHTYVUOJKS-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.36 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (1-methyl-3-phenylpiperidin-4-yl) 3-methoxypropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-methyl-3-phenylpiperidin-4-yl) 3-methoxypropanoate?
The IUPAC name of (1-methyl-3-phenylpiperidin-4-yl) 3-methoxypropanoate (CID 3030759) is (1-methyl-3-phenylpiperidin-4-yl) 3-methoxypropanoate.
What is the SMILES notation for (1-methyl-3-phenylpiperidin-4-yl) 3-methoxypropanoate?
The canonical SMILES for (1-methyl-3-phenylpiperidin-4-yl) 3-methoxypropanoate is COCCC(=O)OC1CCN(C)CC1c1ccccc1.
What is the InChIKey of (1-methyl-3-phenylpiperidin-4-yl) 3-methoxypropanoate?
The InChIKey is XXBPAHTYVUOJKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23NO3/c1-17-10-8-15(20-16(18)9-11-19-2)14(12-17)13-6-4-3-5-7-13/h3-7,14-15H,8-12H2,1-2H3.
What are the key properties of (1-methyl-3-phenylpiperidin-4-yl) 3-methoxypropanoate?
(1-methyl-3-phenylpiperidin-4-yl) 3-methoxypropanoate has a molecular weight of 277.36 g/mol, XLogP of 2.05, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1-methyl-3-phenylpiperidin-4-yl) 3-methoxypropanoate is sourced from PubChem (CID 3030759), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).